C19H21BN6O2 — CID 178083674
CID 178083674 (PubChem CID 178083674) has the molecular formula C19H21BN6O2 and a molecular weight of 376.23 g/mol.
| Compound Name | CID 178083674 |
|---|---|
| PubChem CID | 178083674 |
| Molecular Formula | C19H21BN6O2 |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | — |
| SMILES | [B]c1nc(N)cc(Nc2cc(C)c3n(c2=O)C2(CCC4(CC4)CC2)NC3=O)n1 |
| InChI | InChI=1S/C19H21BN6O2/c1-10-8-11(22-13-9-12(21)23-17(20)24-13)16(28)26-14(10)15(27)25-19(26)6-4-18(2-3-18)5-7-19/h8-9H,2-7H2,1H3,(H,25,27)(H3,21,22,23,24) |
| InChIKey | CGGLUUFCNLBCSM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|