C19H24N6O2 — CID 167283236
11-[(6-aminopyrimidin-4-yl)amino]-13-methylspiro[2,3,4,5,7,8-hexahydropyrido[1,2-a][1,4]diazecine-6,1'-cyclopropane]-1,10-dione (PubChem CID 167283236) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 11-[(6-aminopyrimidin-4-yl)amino]-13-methylspiro[2,3,4,5,7,8-hexahydropyrido[1,2-a][1,4]diazecine-6,1'-cyclopropane]-1,10-dione.
| Compound Name | 11-[(6-aminopyrimidin-4-yl)amino]-13-methylspiro[2,3,4,5,7,8-hexahydropyrido[1,2-a][1,4]diazecine-6,1'-cyclopropane]-1,10-dione |
|---|---|
| PubChem CID | 167283236 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 11-[(6-aminopyrimidin-4-yl)amino]-13-methylspiro[2,3,4,5,7,8-hexahydropyrido[1,2-a][1,4]diazecine-6,1'-cyclopropane]-1,10-dione |
| SMILES | Cc1cc(Nc2cc(N)ncn2)c(=O)n2c1C(=O)NCCCC1(CC2)CC1 |
| InChI | InChI=1S/C19H24N6O2/c1-12-9-13(24-15-10-14(20)22-11-23-15)18(27)25-8-6-19(4-5-19)3-2-7-21-17(26)16(12)25/h9-11H,2-8H2,1H3,(H,21,26)(H3,20,22,23,24) |
| InChIKey | AMHGHCVEEWKOID-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |