C19H19F3N6O2 — CID 162430989
6-[(6-aminopyrimidin-4-yl)amino]-8-methyl-1'-(2,2,2-trifluoroethyl)spiro[2H-imidazo[1,5-a]pyridine-3,3'-cyclohexene]-1,5-dione (PubChem CID 162430989) has the molecular formula C19H19F3N6O2 and a molecular weight of 420.40 g/mol. Its IUPAC name is 6-[(6-aminopyrimidin-4-yl)amino]-8-methyl-1'-(2,2,2-trifluoroethyl)spiro[2H-imidazo[1,5-a]pyridine-3,3'-cyclohexene]-1,5-dione.
| Compound Name | 6-[(6-aminopyrimidin-4-yl)amino]-8-methyl-1'-(2,2,2-trifluoroethyl)spiro[2H-imidazo[1,5-a]pyridine-3,3'-cyclohexene]-1,5-dione |
|---|---|
| PubChem CID | 162430989 |
| Molecular Formula | C19H19F3N6O2 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 6-[(6-aminopyrimidin-4-yl)amino]-8-methyl-1'-(2,2,2-trifluoroethyl)spiro[2H-imidazo[1,5-a]pyridine-3,3'-cyclohexene]-1,5-dione |
| SMILES | Cc1cc(Nc2cc(N)ncn2)c(=O)n2c1C(=O)NC21C=C(CC(F)(F)F)CCC1 |
| InChI | InChI=1S/C19H19F3N6O2/c1-10-5-12(26-14-6-13(23)24-9-25-14)17(30)28-15(10)16(29)27-18(28)4-2-3-11(7-18)8-19(20,21)22/h5-7,9H,2-4,8H2,1H3,(H,27,29)(H3,23,24,25,26) |
| InChIKey | OBSBJNSMPSNIKY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|