C25H37N7O4 — CID 177163135
[14-[(6-aminopyrimidin-4-yl)amino]-5,5,7,7,12-pentamethyl-10,15-dioxo-1,6,9-triazabicyclo[9.4.0]pentadeca-11,13-dien-6-yl] 2-methylpropanoate (PubChem CID 177163135) has the molecular formula C25H37N7O4 and a molecular weight of 499.62 g/mol. Its IUPAC name is [14-[(6-aminopyrimidin-4-yl)amino]-5,5,7,7,12-pentamethyl-10,15-dioxo-1,6,9-triazabicyclo[9.4.0]pentadeca-11,13-dien-6-yl] 2-methylpropanoate.
| Compound Name | [14-[(6-aminopyrimidin-4-yl)amino]-5,5,7,7,12-pentamethyl-10,15-dioxo-1,6,9-triazabicyclo[9.4.0]pentadeca-11,13-dien-6-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 177163135 |
| Molecular Formula | C25H37N7O4 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | [14-[(6-aminopyrimidin-4-yl)amino]-5,5,7,7,12-pentamethyl-10,15-dioxo-1,6,9-triazabicyclo[9.4.0]pentadeca-11,13-dien-6-yl] 2-methylpropanoate |
| SMILES | Cc1cc(Nc2cc(N)ncn2)c(=O)n2c1C(=O)NCC(C)(C)N(OC(=O)C(C)C)C(C)(C)CCC2 |
| InChI | InChI=1S/C25H37N7O4/c1-15(2)23(35)36-32-24(4,5)9-8-10-31-20(21(33)27-13-25(32,6)7)16(3)11-17(22(31)34)30-19-12-18(26)28-14-29-19/h11-12,14-15H,8-10,13H2,1-7H3,(H,27,33)(H3,26,28,29,30) |
| InChIKey | KVKFFRYSEQVZNI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 144.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |