C19H21N5O2 — CID 170239944
6-[(6-aminopyrimidin-4-yl)amino]-5'-ethyl-8-methylspiro[2H-indolizine-3,3'-cyclopentene]-1,5-dione (PubChem CID 170239944) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 6-[(6-aminopyrimidin-4-yl)amino]-5'-ethyl-8-methylspiro[2H-indolizine-3,3'-cyclopentene]-1,5-dione.
| Compound Name | 6-[(6-aminopyrimidin-4-yl)amino]-5'-ethyl-8-methylspiro[2H-indolizine-3,3'-cyclopentene]-1,5-dione |
|---|---|
| PubChem CID | 170239944 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 6-[(6-aminopyrimidin-4-yl)amino]-5'-ethyl-8-methylspiro[2H-indolizine-3,3'-cyclopentene]-1,5-dione |
| SMILES | CCC1C=CC2(CC(=O)c3c(C)cc(Nc4cc(N)ncn4)c(=O)n32)C1 |
| InChI | InChI=1S/C19H21N5O2/c1-3-12-4-5-19(8-12)9-14(25)17-11(2)6-13(18(26)24(17)19)23-16-7-15(20)21-10-22-16/h4-7,10,12H,3,8-9H2,1-2H3,(H3,20,21,22,23) |
| InChIKey | JJZZBMCHSYJEBV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|