C19H20F2N6O4 — CID 162431054
2,2-difluoro-N-[6-[(12-methyl-1,9-dioxo-3,4,6,7-tetrahydro-2H-pyrido[1,2-d][1,4,7]oxadiazonin-10-yl)amino]pyrimidin-4-yl]cyclopropane-1-carboxamide (PubChem CID 162431054) has the molecular formula C19H20F2N6O4 and a molecular weight of 434.40 g/mol. Its IUPAC name is 2,2-difluoro-N-[6-[(12-methyl-1,9-dioxo-3,4,6,7-tetrahydro-2H-pyrido[1,2-d][1,4,7]oxadiazonin-10-yl)amino]pyrimidin-4-yl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-difluoro-N-[6-[(12-methyl-1,9-dioxo-3,4,6,7-tetrahydro-2H-pyrido[1,2-d][1,4,7]oxadiazonin-10-yl)amino]pyrimidin-4-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 162431054 |
| Molecular Formula | C19H20F2N6O4 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2,2-difluoro-N-[6-[(12-methyl-1,9-dioxo-3,4,6,7-tetrahydro-2H-pyrido[1,2-d][1,4,7]oxadiazonin-10-yl)amino]pyrimidin-4-yl]cyclopropane-1-carboxamide |
| SMILES | Cc1cc(Nc2cc(NC(=O)C3CC3(F)F)ncn2)c(=O)n2c1C(=O)NCCOCC2 |
| InChI | InChI=1S/C19H20F2N6O4/c1-10-6-12(18(30)27-3-5-31-4-2-22-17(29)15(10)27)25-13-7-14(24-9-23-13)26-16(28)11-8-19(11,20)21/h6-7,9,11H,2-5,8H2,1H3,(H,22,29)(H2,23,24,25,26,28) |
| InChIKey | KNHKTAINCJWPIU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |