C19H21ClN6O2 — CID 130444088
CID 130444088 (PubChem CID 130444088) has the molecular formula C19H21ClN6O2 and a molecular weight of 400.87 g/mol.
| Compound Name | CID 130444088 |
|---|---|
| PubChem CID | 130444088 |
| Molecular Formula | C19H21ClN6O2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | — |
| SMILES | Nc1cc(Nc2cc(Cl)c3n(c2=O)C2(CCCC4(CCC4)C2)NC3=O)ncn1 |
| InChI | InChI=1S/C19H21ClN6O2/c20-11-7-12(24-14-8-13(21)22-10-23-14)17(28)26-15(11)16(27)25-19(26)6-2-5-18(9-19)3-1-4-18/h7-8,10H,1-6,9H2,(H,25,27)(H3,21,22,23,24) |
| InChIKey | HZOPSKZOAHEUAB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |