About CID 130444088
CID 130444088 (PubChem CID 130444088) has the molecular formula C19H21ClN6O2
and a molecular weight of 400.87 g/mol.
Molecular Properties
| Compound Name | CID 130444088 |
| PubChem CID | 130444088 |
| Molecular Formula | C19H21ClN6O2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | — |
| SMILES | Nc1cc(Nc2cc(Cl)c3n(c2=O)C2(CCCC4(CCC4)C2)NC3=O)ncn1 |
| InChI | InChI=1S/C19H21ClN6O2/c20-11-7-12(24-14-8-13(21)22-10-23-14)17(28)26-15(11)16(27)25-19(26)6-2-5-18(9-19)3-1-4-18/h7-8,10H,1-6,9H2,(H,25,27)(H3,21,22,23,24) |
| InChIKey | HZOPSKZOAHEUAB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 130444088 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 130444088?
The IUPAC name of CID 130444088 (CID 130444088) is not available.
What is the SMILES notation for CID 130444088?
The canonical SMILES for CID 130444088 is Nc1cc(Nc2cc(Cl)c3n(c2=O)C2(CCCC4(CCC4)C2)NC3=O)ncn1.
What is the InChIKey of CID 130444088?
The InChIKey is HZOPSKZOAHEUAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN6O2/c20-11-7-12(24-14-8-13(21)22-10-23-14)17(28)26-15(11)16(27)25-19(26)6-2-5-18(9-19)3-1-4-18/h7-8,10H,1-6,9H2,(H,25,27)(H3,21,22,23,24).
What are the key properties of CID 130444088?
CID 130444088 has a molecular weight of 400.87 g/mol, XLogP of 2.76, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 130444088 is sourced from PubChem (CID 130444088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).