C15H15N3O — CID 114765717
2-(2-methoxy-5-methylanilino)-6-methylpyridine-4-carbonitrile (PubChem CID 114765717) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2-methoxy-5-methylanilino)-6-methylpyridine-4-carbonitrile.
| Compound Name | 2-(2-methoxy-5-methylanilino)-6-methylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114765717 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-(2-methoxy-5-methylanilino)-6-methylpyridine-4-carbonitrile |
| SMILES | COc1ccc(C)cc1Nc1cc(C#N)cc(C)n1 |
| InChI | InChI=1S/C15H15N3O/c1-10-4-5-14(19-3)13(6-10)18-15-8-12(9-16)7-11(2)17-15/h4-8H,1-3H3,(H,17,18) |
| InChIKey | DKDBXIKUGVNRCK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |