C14H11BrFN3 — CID 114766691
2-(4-bromo-5-fluoro-2-methylanilino)-6-methylpyridine-4-carbonitrile (PubChem CID 114766691) has the molecular formula C14H11BrFN3 and a molecular weight of 320.17 g/mol. Its IUPAC name is 2-(4-bromo-5-fluoro-2-methylanilino)-6-methylpyridine-4-carbonitrile.
| Compound Name | 2-(4-bromo-5-fluoro-2-methylanilino)-6-methylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114766691 |
| Molecular Formula | C14H11BrFN3 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 2-(4-bromo-5-fluoro-2-methylanilino)-6-methylpyridine-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(Nc2cc(F)c(Br)cc2C)n1 |
| InChI | InChI=1S/C14H11BrFN3/c1-8-3-11(15)12(16)6-13(8)19-14-5-10(7-17)4-9(2)18-14/h3-6H,1-2H3,(H,18,19) |
| InChIKey | GITVXZXCBYCJHE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |