C11H10F3N3 — CID 114159032
2-methyl-6-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-4-carbonitrile (PubChem CID 114159032) has the molecular formula C11H10F3N3 and a molecular weight of 241.22 g/mol. Its IUPAC name is 2-methyl-6-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-4-carbonitrile.
| Compound Name | 2-methyl-6-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114159032 |
| Molecular Formula | C11H10F3N3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-methyl-6-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(NC2(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C11H10F3N3/c1-7-4-8(6-15)5-9(16-7)17-10(2-3-10)11(12,13)14/h4-5H,2-3H2,1H3,(H,16,17) |
| InChIKey | MPYQGWYUNMYILF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |