About 2-cyano-3,4-difluorobenzamide
2-cyano-3,4-difluorobenzamide (PubChem CID 131009208) has the molecular formula C8H4F2N2O
and a molecular weight of 182.13 g/mol. Its IUPAC name is 2-cyano-3,4-difluorobenzamide.
Molecular Properties
| Compound Name | 2-cyano-3,4-difluorobenzamide |
| PubChem CID | 131009208 |
| Molecular Formula | C8H4F2N2O |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 2-cyano-3,4-difluorobenzamide |
| SMILES | N#Cc1c(C(N)=O)ccc(F)c1F |
| InChI | InChI=1S/C8H4F2N2O/c9-6-2-1-4(8(12)13)5(3-11)7(6)10/h1-2H,(H2,12,13) |
| InChIKey | CPOHWWHMGGKLAS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyano-3,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-3,4-difluorobenzamide?
The IUPAC name of 2-cyano-3,4-difluorobenzamide (CID 131009208) is 2-cyano-3,4-difluorobenzamide.
What is the SMILES notation for 2-cyano-3,4-difluorobenzamide?
The canonical SMILES for 2-cyano-3,4-difluorobenzamide is N#Cc1c(C(N)=O)ccc(F)c1F.
What is the InChIKey of 2-cyano-3,4-difluorobenzamide?
The InChIKey is CPOHWWHMGGKLAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F2N2O/c9-6-2-1-4(8(12)13)5(3-11)7(6)10/h1-2H,(H2,12,13).
What are the key properties of 2-cyano-3,4-difluorobenzamide?
2-cyano-3,4-difluorobenzamide has a molecular weight of 182.13 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-3,4-difluorobenzamide is sourced from PubChem (CID 131009208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).