C11H8FNO — CID 129390000
(1S)-5-fluoro-1-formyl-2,3-dihydro-1H-indene-4-carbonitrile (PubChem CID 129390000) has the molecular formula C11H8FNO and a molecular weight of 189.19 g/mol. Its IUPAC name is (1S)-5-fluoro-1-formyl-2,3-dihydro-1H-indene-4-carbonitrile.
| Compound Name | (1S)-5-fluoro-1-formyl-2,3-dihydro-1H-indene-4-carbonitrile |
|---|---|
| PubChem CID | 129390000 |
| Molecular Formula | C11H8FNO |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (1S)-5-fluoro-1-formyl-2,3-dihydro-1H-indene-4-carbonitrile |
| SMILES | N#Cc1c(F)ccc2c1CC[C@@H]2C=O |
| InChI | InChI=1S/C11H8FNO/c12-11-4-3-8-7(6-14)1-2-9(8)10(11)5-13/h3-4,6-7H,1-2H2/t7-/m1/s1 |
| InChIKey | LLWLGMBSHGPRJM-SSDOTTSWSA-N |
| XLogP | 1.93 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|