C19H23FN2O2 — CID 125499288
tert-butyl N-[[(1S)-4-cyano-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-N-prop-2-enylcarbamate (PubChem CID 125499288) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is tert-butyl N-[[(1S)-4-cyano-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[[(1S)-4-cyano-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 125499288 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | tert-butyl N-[[(1S)-4-cyano-5-fluoro-2,3-dihydro-1H-inden-1-yl]methyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C[C@H]1CCc2c1ccc(F)c2C#N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H23FN2O2/c1-5-10-22(18(23)24-19(2,3)4)12-13-6-7-15-14(13)8-9-17(20)16(15)11-21/h5,8-9,13H,1,6-7,10,12H2,2-4H3/t13-/m1/s1 |
| InChIKey | DKVUZOBQTIAQGE-CYBMUJFWSA-N |
| XLogP | 4.15 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|