C12H11NO — CID 124584420
(5S)-5-formyl-5,6,7,8-tetrahydronaphthalene-1-carbonitrile (PubChem CID 124584420) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is (5S)-5-formyl-5,6,7,8-tetrahydronaphthalene-1-carbonitrile.
| Compound Name | (5S)-5-formyl-5,6,7,8-tetrahydronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 124584420 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | (5S)-5-formyl-5,6,7,8-tetrahydronaphthalene-1-carbonitrile |
| SMILES | N#Cc1cccc2c1CCC[C@@H]2C=O |
| InChI | InChI=1S/C12H11NO/c13-7-9-3-1-6-12-10(8-14)4-2-5-11(9)12/h1,3,6,8,10H,2,4-5H2/t10-/m1/s1 |
| InChIKey | ZZJJRSJXWKYWKV-SNVBAGLBSA-N |
| XLogP | 2.18 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|