C12H11NO — CID 123919629
5-isocyano-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde (PubChem CID 123919629) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is 5-isocyano-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde.
| Compound Name | 5-isocyano-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 123919629 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 5-isocyano-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
| SMILES | [C-]#[N+]c1cccc2c1CCCC2C=O |
| InChI | InChI=1S/C12H11NO/c1-13-12-7-3-5-10-9(8-14)4-2-6-11(10)12/h3,5,7-9H,2,4,6H2 |
| InChIKey | RUZBKGTWZFWWNW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|