C11H13N2P — CID 158008004
(1S)-4-isocyano-N-methyl-N-phosphanyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 158008004) has the molecular formula C11H13N2P and a molecular weight of 204.21 g/mol. Its IUPAC name is (1S)-4-isocyano-N-methyl-N-phosphanyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S)-4-isocyano-N-methyl-N-phosphanyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 158008004 |
| Molecular Formula | C11H13N2P |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (1S)-4-isocyano-N-methyl-N-phosphanyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | [C-]#[N+]c1cccc2c1CC[C@@H]2N(C)P |
| InChI | InChI=1S/C11H13N2P/c1-12-10-5-3-4-9-8(10)6-7-11(9)13(2)14/h3-5,11H,6-7,14H2,2H3/t11-/m0/s1 |
| InChIKey | GIANREJKKTZVQM-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|