C16H7F4NO — CID 135025586
2,3,5,6-tetrafluoro-4-[(E)-3-oxo-3-phenylprop-1-enyl]benzonitrile (PubChem CID 135025586) has the molecular formula C16H7F4NO and a molecular weight of 305.23 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(E)-3-oxo-3-phenylprop-1-enyl]benzonitrile.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(E)-3-oxo-3-phenylprop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 135025586 |
| Molecular Formula | C16H7F4NO |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(E)-3-oxo-3-phenylprop-1-enyl]benzonitrile |
| SMILES | N#Cc1c(F)c(F)c(/C=C/C(=O)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C16H7F4NO/c17-13-10(14(18)16(20)11(8-21)15(13)19)6-7-12(22)9-4-2-1-3-5-9/h1-7H/b7-6+ |
| InChIKey | CWNRAMFVCRYIFM-VOTSOKGWSA-N |
| XLogP | 4.01 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|