C15H6BrF5O — CID 6160846
(E)-1-(2-bromophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one (PubChem CID 6160846) has the molecular formula C15H6BrF5O and a molecular weight of 377.11 g/mol. Its IUPAC name is (E)-1-(2-bromophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-bromophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6160846 |
| Molecular Formula | C15H6BrF5O |
| Molecular Weight | 377.11 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | (E)-1-(2-bromophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(F)c(F)c(F)c(F)c1F)c1ccccc1Br |
| InChI | InChI=1S/C15H6BrF5O/c16-9-4-2-1-3-7(9)10(22)6-5-8-11(17)13(19)15(21)14(20)12(8)18/h1-6H/b6-5+ |
| InChIKey | BRDPVGWHSFQTAJ-AATRIKPKSA-N |
| XLogP | 5.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.11 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|