C30H3F12N5 — CID 174103612
4-[[2-[amino-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-3-[cyano-(4-ethynyl-2,3,5,6-tetrafluorophenyl)methylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 174103612) has the molecular formula C30H3F12N5 and a molecular weight of 661.37 g/mol. Its IUPAC name is 4-[[2-[amino-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-3-[cyano-(4-ethynyl-2,3,5,6-tetrafluorophenyl)methylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[[2-[amino-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-3-[cyano-(4-ethynyl-2,3,5,6-tetrafluorophenyl)methylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 174103612 |
| Molecular Formula | C30H3F12N5 |
| Molecular Weight | 661.37 g/mol |
| Exact Mass | 661.02 |
| IUPAC Name | 4-[[2-[amino-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-3-[cyano-(4-ethynyl-2,3,5,6-tetrafluorophenyl)methylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | C#Cc1c(F)c(F)c(C(C#N)=C2C(=C(N)c3c(F)c(F)c(C#N)c(F)c3F)C2=C(C#N)c2c(F)c(F)c(C#N)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C30H3F12N5/c1-2-7-18(31)24(37)14(25(38)19(7)32)8(3-43)12-13(9(4-44)15-26(39)20(33)10(5-45)21(34)27(15)40)16(12)30(47)17-28(41)22(35)11(6-46)23(36)29(17)42/h1H,47H2 |
| InChIKey | DRZPPAPGJWQTQK-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.37 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|