C29H5F12N5 — CID 174029503
4-[[2-[amino-(4-ethynyl-2,3,5,6-tetrafluorophenyl)methylidene]-3-[(4-amino-2,3,5,6-tetrafluorophenyl)-cyanomethylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 174029503) has the molecular formula C29H5F12N5 and a molecular weight of 651.37 g/mol. Its IUPAC name is 4-[[2-[amino-(4-ethynyl-2,3,5,6-tetrafluorophenyl)methylidene]-3-[(4-amino-2,3,5,6-tetrafluorophenyl)-cyanomethylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[[2-[amino-(4-ethynyl-2,3,5,6-tetrafluorophenyl)methylidene]-3-[(4-amino-2,3,5,6-tetrafluorophenyl)-cyanomethylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 174029503 |
| Molecular Formula | C29H5F12N5 |
| Molecular Weight | 651.37 g/mol |
| Exact Mass | 651.04 |
| IUPAC Name | 4-[[2-[amino-(4-ethynyl-2,3,5,6-tetrafluorophenyl)methylidene]-3-[(4-amino-2,3,5,6-tetrafluorophenyl)-cyanomethylidene]cyclopropylidene]-cyanomethyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | C#Cc1c(F)c(F)c(C(N)=C2C(=C(C#N)c3c(F)c(F)c(N)c(F)c3F)C2=C(C#N)c2c(F)c(F)c(C#N)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C29H5F12N5/c1-2-6-16(30)24(38)15(25(39)17(6)31)28(45)14-10(7(3-42)12-20(34)18(32)9(5-44)19(33)21(12)35)11(14)8(4-43)13-22(36)26(40)29(46)27(41)23(13)37/h1H,45-46H2 |
| InChIKey | DJIKZGNYVGQRIO-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.37 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|