C33H3F15N6 — CID 158450436
4-[[2,3-bis[cyano-[4-cyano-2,3,6-trifluoro-5-(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-cyanomethyl]-2,3,5-trifluoro-6-methylbenzonitrile (PubChem CID 158450436) has the molecular formula C33H3F15N6 and a molecular weight of 768.40 g/mol. Its IUPAC name is 4-[[2,3-bis[cyano-[4-cyano-2,3,6-trifluoro-5-(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-cyanomethyl]-2,3,5-trifluoro-6-methylbenzonitrile.
| Compound Name | 4-[[2,3-bis[cyano-[4-cyano-2,3,6-trifluoro-5-(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-cyanomethyl]-2,3,5-trifluoro-6-methylbenzonitrile |
|---|---|
| PubChem CID | 158450436 |
| Molecular Formula | C33H3F15N6 |
| Molecular Weight | 768.40 g/mol |
| Exact Mass | 768.02 |
| IUPAC Name | 4-[[2,3-bis[cyano-[4-cyano-2,3,6-trifluoro-5-(trifluoromethyl)phenyl]methylidene]cyclopropylidene]-cyanomethyl]-2,3,5-trifluoro-6-methylbenzonitrile |
| SMILES | Cc1c(F)c(C(C#N)=C2C(=C(C#N)c3c(F)c(F)c(C#N)c(C(F)(F)F)c3F)C2=C(C#N)c2c(F)c(F)c(C#N)c(C(F)(F)F)c2F)c(F)c(F)c1C#N |
| InChI | InChI=1S/C33H3F15N6/c1-8-9(2-49)24(35)29(40)18(23(8)34)10(3-50)15-16(11(4-51)19-27(38)21(32(43,44)45)13(6-53)25(36)30(19)41)17(15)12(5-52)20-28(39)22(33(46,47)48)14(7-54)26(37)31(20)42/h1H3 |
| InChIKey | MKPGRZDBWIGHPE-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.40 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|