C12ClF2N5 — CID 15663969
6-[chloro(difluoro)methyl]benzene-1,2,3,4,5-pentacarbonitrile (PubChem CID 15663969) has the molecular formula C12ClF2N5 and a molecular weight of 287.62 g/mol. Its IUPAC name is 6-[chloro(difluoro)methyl]benzene-1,2,3,4,5-pentacarbonitrile.
| Compound Name | 6-[chloro(difluoro)methyl]benzene-1,2,3,4,5-pentacarbonitrile |
|---|---|
| PubChem CID | 15663969 |
| Molecular Formula | C12ClF2N5 |
| Molecular Weight | 287.62 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 6-[chloro(difluoro)methyl]benzene-1,2,3,4,5-pentacarbonitrile |
| SMILES | N#Cc1c(C#N)c(C#N)c(C(F)(F)Cl)c(C#N)c1C#N |
| InChI | InChI=1S/C12ClF2N5/c13-12(14,15)11-9(4-19)7(2-17)6(1-16)8(3-18)10(11)5-20 |
| InChIKey | SFEGRVHMBPBPGE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.62 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|