C12N6 — CID 12902195
benzene-1,2,3,4,5,6-hexacarbonitrile (PubChem CID 12902195) has the molecular formula C12N6 and a molecular weight of 228.17 g/mol. Its IUPAC name is benzene-1,2,3,4,5,6-hexacarbonitrile.
| Compound Name | benzene-1,2,3,4,5,6-hexacarbonitrile |
|---|---|
| PubChem CID | 12902195 |
| Molecular Formula | C12N6 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | benzene-1,2,3,4,5,6-hexacarbonitrile |
| SMILES | N#Cc1c(C#N)c(C#N)c(C#N)c(C#N)c1C#N |
| InChI | InChI=1S/C12N6/c13-1-7-8(2-14)10(4-16)12(6-18)11(5-17)9(7)3-15 |
| InChIKey | YLDBWNXELVQOFK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |