C13F17N — CID 139067327
5-fluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,4,6-tris(trifluoromethyl)benzonitrile (PubChem CID 139067327) has the molecular formula C13F17N and a molecular weight of 493.12 g/mol. Its IUPAC name is 5-fluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,4,6-tris(trifluoromethyl)benzonitrile.
| Compound Name | 5-fluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,4,6-tris(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 139067327 |
| Molecular Formula | C13F17N |
| Molecular Weight | 493.12 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | 5-fluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,4,6-tris(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1c(C(F)(F)F)c(F)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13F17N/c14-7-4(9(16,17)18)2(1-31)3(8(15,12(25,26)27)13(28,29)30)5(10(19,20)21)6(7)11(22,23)24 |
| InChIKey | VQEMEHXPBRCHPK-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.12 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |