C10H4F6N4 — CID 139999983
2,4-diamino-5,6-bis(trifluoromethyl)benzene-1,3-dicarbonitrile (PubChem CID 139999983) has the molecular formula C10H4F6N4 and a molecular weight of 294.16 g/mol. Its IUPAC name is 2,4-diamino-5,6-bis(trifluoromethyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2,4-diamino-5,6-bis(trifluoromethyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139999983 |
| Molecular Formula | C10H4F6N4 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2,4-diamino-5,6-bis(trifluoromethyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)c(C(F)(F)F)c(C(F)(F)F)c1N |
| InChI | InChI=1S/C10H4F6N4/c11-9(12,13)5-3(1-17)7(19)4(2-18)8(20)6(5)10(14,15)16/h19-20H2 |
| InChIKey | RGBLPKIOBQCZGH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|