C10H8F3NO — CID 131581484
4-(hydroxymethyl)-2-methyl-3-(trifluoromethyl)benzonitrile (PubChem CID 131581484) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2-methyl-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(hydroxymethyl)-2-methyl-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 131581484 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-(hydroxymethyl)-2-methyl-3-(trifluoromethyl)benzonitrile |
| SMILES | Cc1c(C#N)ccc(CO)c1C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO/c1-6-7(4-14)2-3-8(5-15)9(6)10(11,12)13/h2-3,15H,5H2,1H3 |
| InChIKey | YIDCVCFBLPLZMR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |