C12H9F3N2O3 — CID 162563846
2-[4-cyano-2-methyl-3-(trifluoromethyl)phenyl]imino-3-hydroxypropanoic acid (PubChem CID 162563846) has the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-[4-cyano-2-methyl-3-(trifluoromethyl)phenyl]imino-3-hydroxypropanoic acid.
| Compound Name | 2-[4-cyano-2-methyl-3-(trifluoromethyl)phenyl]imino-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 162563846 |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-[4-cyano-2-methyl-3-(trifluoromethyl)phenyl]imino-3-hydroxypropanoic acid |
| SMILES | Cc1c(/N=C(\CO)C(=O)O)ccc(C#N)c1C(F)(F)F |
| InChI | InChI=1S/C12H9F3N2O3/c1-6-8(17-9(5-18)11(19)20)3-2-7(4-16)10(6)12(13,14)15/h2-3,18H,5H2,1H3,(H,19,20)/b17-9+ |
| InChIKey | RCHSUEVLGVSXQT-RQZCQDPDSA-N |
| XLogP | 2.03 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|