C16H18Cl2O — CID 70291000
1,2-bis(chloromethyl)-3,4-dimethylbenzene;phenol (PubChem CID 70291000) has the molecular formula C16H18Cl2O and a molecular weight of 297.22 g/mol. Its IUPAC name is 1,2-bis(chloromethyl)-3,4-dimethylbenzene;phenol.
| Compound Name | 1,2-bis(chloromethyl)-3,4-dimethylbenzene;phenol |
|---|---|
| PubChem CID | 70291000 |
| Molecular Formula | C16H18Cl2O |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1,2-bis(chloromethyl)-3,4-dimethylbenzene;phenol |
| SMILES | Cc1ccc(CCl)c(CCl)c1C.Oc1ccccc1 |
| InChI | InChI=1S/C10H12Cl2.C6H6O/c1-7-3-4-9(5-11)10(6-12)8(7)2;7-6-4-2-1-3-5-6/h3-4H,5-6H2,1-2H3;1-5,7H |
| InChIKey | KMBOKRFCZIWGIL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|