C12H19F3O — CID 145173786
fluoromethane;1-(fluoromethoxy)-2,4,5-trimethylbenzene (PubChem CID 145173786) has the molecular formula C12H19F3O and a molecular weight of 236.28 g/mol. Its IUPAC name is fluoromethane;1-(fluoromethoxy)-2,4,5-trimethylbenzene.
| Compound Name | fluoromethane;1-(fluoromethoxy)-2,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 145173786 |
| Molecular Formula | C12H19F3O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | fluoromethane;1-(fluoromethoxy)-2,4,5-trimethylbenzene |
| SMILES | CF.CF.Cc1cc(C)c(OCF)cc1C |
| InChI | InChI=1S/C10H13FO.2CH3F/c1-7-4-9(3)10(12-6-11)5-8(7)2;2*1-2/h4-5H,6H2,1-3H3;2*1H3 |
| InChIKey | NDGGHHMRVPZMFH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |