C12H17NOS — CID 82154229
3-(2,4,5-trimethylphenoxy)propanethioamide (PubChem CID 82154229) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 3-(2,4,5-trimethylphenoxy)propanethioamide.
| Compound Name | 3-(2,4,5-trimethylphenoxy)propanethioamide |
|---|---|
| PubChem CID | 82154229 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-(2,4,5-trimethylphenoxy)propanethioamide |
| SMILES | Cc1cc(C)c(OCCC(N)=S)cc1C |
| InChI | InChI=1S/C12H17NOS/c1-8-6-10(3)11(7-9(8)2)14-5-4-12(13)15/h6-7H,4-5H2,1-3H3,(H2,13,15) |
| InChIKey | ZRVRTSUJVXQODZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|