C11H15NOS — CID 7745565
3-(2,3-dimethylphenoxy)propanethioamide (PubChem CID 7745565) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 3-(2,3-dimethylphenoxy)propanethioamide.
| Compound Name | 3-(2,3-dimethylphenoxy)propanethioamide |
|---|---|
| PubChem CID | 7745565 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 3-(2,3-dimethylphenoxy)propanethioamide |
| SMILES | Cc1cccc(OCCC(N)=S)c1C |
| InChI | InChI=1S/C11H15NOS/c1-8-4-3-5-10(9(8)2)13-7-6-11(12)14/h3-5H,6-7H2,1-2H3,(H2,12,14) |
| InChIKey | IMMWTXSYFRYWFI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|