C42H50O3 — CID 121306738
[2-methyl-4-[2-[2,4,6-tris(1-phenylethyl)phenyl]propan-2-yloxy]butan-2-yl] 2-methylprop-2-enoate (PubChem CID 121306738) has the molecular formula C42H50O3 and a molecular weight of 602.86 g/mol. Its IUPAC name is [2-methyl-4-[2-[2,4,6-tris(1-phenylethyl)phenyl]propan-2-yloxy]butan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2-methyl-4-[2-[2,4,6-tris(1-phenylethyl)phenyl]propan-2-yloxy]butan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121306738 |
| Molecular Formula | C42H50O3 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 602.38 |
| IUPAC Name | [2-methyl-4-[2-[2,4,6-tris(1-phenylethyl)phenyl]propan-2-yloxy]butan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CCOC(C)(C)c1c(C(C)c2ccccc2)cc(C(C)c2ccccc2)cc1C(C)c1ccccc1 |
| InChI | InChI=1S/C42H50O3/c1-29(2)40(43)45-41(6,7)25-26-44-42(8,9)39-37(31(4)34-21-15-11-16-22-34)27-36(30(3)33-19-13-10-14-20-33)28-38(39)32(5)35-23-17-12-18-24-35/h10-24,27-28,30-32H,1,25-26H2,2-9H3 |
| InChIKey | XESJHWVOPLLRHE-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|