C38H46O — CID 91087300
2-[2-(3-methylbutoxy)propan-2-yl]-1,3,5-tris(1-phenylethyl)benzene (PubChem CID 91087300) has the molecular formula C38H46O and a molecular weight of 518.79 g/mol. Its IUPAC name is 2-[2-(3-methylbutoxy)propan-2-yl]-1,3,5-tris(1-phenylethyl)benzene.
| Compound Name | 2-[2-(3-methylbutoxy)propan-2-yl]-1,3,5-tris(1-phenylethyl)benzene |
|---|---|
| PubChem CID | 91087300 |
| Molecular Formula | C38H46O |
| Molecular Weight | 518.79 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | 2-[2-(3-methylbutoxy)propan-2-yl]-1,3,5-tris(1-phenylethyl)benzene |
| SMILES | CC(C)CCOC(C)(C)c1c(C(C)c2ccccc2)cc(C(C)c2ccccc2)cc1C(C)c1ccccc1 |
| InChI | InChI=1S/C38H46O/c1-27(2)23-24-39-38(6,7)37-35(29(4)32-19-13-9-14-20-32)25-34(28(3)31-17-11-8-12-18-31)26-36(37)30(5)33-21-15-10-16-22-33/h8-22,25-30H,23-24H2,1-7H3 |
| InChIKey | HFOYDYFZLLXQNS-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.79 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |