C26H23I — CID 89150372
[(2E)-2-[(Z)-3-iodoprop-1-enyl]-1,1-diphenylpenta-2,4-dienyl]benzene (PubChem CID 89150372) has the molecular formula C26H23I and a molecular weight of 462.37 g/mol. Its IUPAC name is [(2E)-2-[(Z)-3-iodoprop-1-enyl]-1,1-diphenylpenta-2,4-dienyl]benzene.
| Compound Name | [(2E)-2-[(Z)-3-iodoprop-1-enyl]-1,1-diphenylpenta-2,4-dienyl]benzene |
|---|---|
| PubChem CID | 89150372 |
| Molecular Formula | C26H23I |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | [(2E)-2-[(Z)-3-iodoprop-1-enyl]-1,1-diphenylpenta-2,4-dienyl]benzene |
| SMILES | C=C/C=C(\C=C/CI)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H23I/c1-2-13-22(20-12-21-27)26(23-14-6-3-7-15-23,24-16-8-4-9-17-24)25-18-10-5-11-19-25/h2-20H,1,21H2/b20-12-,22-13+ |
| InChIKey | LXHFFHZXJZPYSZ-DKNDRJFASA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|