C19H19P — CID 145229203
[(3E,5Z)-hepta-1,3,5-trien-4-yl]-(4-phenylphenyl)phosphane (PubChem CID 145229203) has the molecular formula C19H19P and a molecular weight of 278.34 g/mol. Its IUPAC name is [(3E,5Z)-hepta-1,3,5-trien-4-yl]-(4-phenylphenyl)phosphane.
| Compound Name | [(3E,5Z)-hepta-1,3,5-trien-4-yl]-(4-phenylphenyl)phosphane |
|---|---|
| PubChem CID | 145229203 |
| Molecular Formula | C19H19P |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [(3E,5Z)-hepta-1,3,5-trien-4-yl]-(4-phenylphenyl)phosphane |
| SMILES | C=C/C=C(\C=C/C)Pc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19P/c1-3-8-18(9-4-2)20-19-14-12-17(13-15-19)16-10-6-5-7-11-16/h3-15,20H,1H2,2H3/b9-4-,18-8+ |
| InChIKey | WRPJSWXPWPVDQV-ZFHQFQHJSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|