C28H35NO4 — CID 70653645
2-[bis(4-methoxyphenyl)-phenylmethyl]-2-(butylamino)propane-1,3-diol (PubChem CID 70653645) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is 2-[bis(4-methoxyphenyl)-phenylmethyl]-2-(butylamino)propane-1,3-diol.
| Compound Name | 2-[bis(4-methoxyphenyl)-phenylmethyl]-2-(butylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 70653645 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 2-[bis(4-methoxyphenyl)-phenylmethyl]-2-(butylamino)propane-1,3-diol |
| SMILES | CCCCNC(CO)(CO)C(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H35NO4/c1-4-5-19-29-27(20-30,21-31)28(22-9-7-6-8-10-22,23-11-15-25(32-2)16-12-23)24-13-17-26(33-3)18-14-24/h6-18,29-31H,4-5,19-21H2,1-3H3 |
| InChIKey | QUWRKVYVTMBALT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|