C21H23NO2 — CID 89221167
4-[(2R,3E)-3-[(Z)-2-aminoethenyl]-2-(4-methoxyphenyl)hexa-3,5-dien-2-yl]phenol (PubChem CID 89221167) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[(2R,3E)-3-[(Z)-2-aminoethenyl]-2-(4-methoxyphenyl)hexa-3,5-dien-2-yl]phenol.
| Compound Name | 4-[(2R,3E)-3-[(Z)-2-aminoethenyl]-2-(4-methoxyphenyl)hexa-3,5-dien-2-yl]phenol |
|---|---|
| PubChem CID | 89221167 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-[(2R,3E)-3-[(Z)-2-aminoethenyl]-2-(4-methoxyphenyl)hexa-3,5-dien-2-yl]phenol |
| SMILES | C=C/C=C(\C=C/N)[C@](C)(c1ccc(O)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-4-5-16(14-15-22)21(2,17-6-10-19(23)11-7-17)18-8-12-20(24-3)13-9-18/h4-15,23H,1,22H2,2-3H3/b15-14-,16-5+/t21-/m1/s1 |
| InChIKey | PFOWMWWEWQUNOS-SOTBDYJISA-N |
| XLogP | 4.29 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|