C28H30N2O2 — CID 18654453
2-[(3S)-1-[2-(4-acetylphenyl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 18654453) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-[(3S)-1-[2-(4-acetylphenyl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(3S)-1-[2-(4-acetylphenyl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 18654453 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-[(3S)-1-[2-(4-acetylphenyl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | CC(=O)c1ccc(CCN2CC[C@@H](C(C(N)=O)(c3ccccc3)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C28H30N2O2/c1-21(31)23-14-12-22(13-15-23)16-18-30-19-17-26(20-30)28(27(29)32,24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-15,26H,16-20H2,1H3,(H2,29,32)/t26-/m1/s1 |
| InChIKey | WGNOHUUSDPNABF-AREMUKBSSA-N |
| XLogP | 4.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |