C33H40N2O4 — CID 20625236
7-[4-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]phenoxy]heptanoic acid (PubChem CID 20625236) has the molecular formula C33H40N2O4 and a molecular weight of 528.69 g/mol. Its IUPAC name is 7-[4-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]phenoxy]heptanoic acid.
| Compound Name | 7-[4-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]phenoxy]heptanoic acid |
|---|---|
| PubChem CID | 20625236 |
| Molecular Formula | C33H40N2O4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 7-[4-[2-[3-(2-amino-2-oxo-1,1-diphenylethyl)pyrrolidin-1-yl]ethyl]phenoxy]heptanoic acid |
| SMILES | NC(=O)C(c1ccccc1)(c1ccccc1)C1CCN(CCc2ccc(OCCCCCCC(=O)O)cc2)C1 |
| InChI | InChI=1S/C33H40N2O4/c34-32(38)33(27-11-5-3-6-12-27,28-13-7-4-8-14-28)29-21-23-35(25-29)22-20-26-16-18-30(19-17-26)39-24-10-2-1-9-15-31(36)37/h3-8,11-14,16-19,29H,1-2,9-10,15,20-25H2,(H2,34,38)(H,36,37) |
| InChIKey | LJLSGSZCXFTJMD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|