C23H30N2O — CID 58847578
1,1-diphenyl-1-[1-(propylaminomethyl)pyrrolidin-3-yl]propan-2-one (PubChem CID 58847578) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 1,1-diphenyl-1-[1-(propylaminomethyl)pyrrolidin-3-yl]propan-2-one.
| Compound Name | 1,1-diphenyl-1-[1-(propylaminomethyl)pyrrolidin-3-yl]propan-2-one |
|---|---|
| PubChem CID | 58847578 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 1,1-diphenyl-1-[1-(propylaminomethyl)pyrrolidin-3-yl]propan-2-one |
| SMILES | CCCNCN1CCC(C(C(C)=O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H30N2O/c1-3-15-24-18-25-16-14-22(17-25)23(19(2)26,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,22,24H,3,14-18H2,1-2H3 |
| InChIKey | LKDWRMWIOKASPX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|