C25H34N2 — CID 123178415
1-(1-ethylpyrrolidin-3-yl)-N-(2-methylpropyl)-1,1-diphenylpropan-2-imine (PubChem CID 123178415) has the molecular formula C25H34N2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 1-(1-ethylpyrrolidin-3-yl)-N-(2-methylpropyl)-1,1-diphenylpropan-2-imine.
| Compound Name | 1-(1-ethylpyrrolidin-3-yl)-N-(2-methylpropyl)-1,1-diphenylpropan-2-imine |
|---|---|
| PubChem CID | 123178415 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 1-(1-ethylpyrrolidin-3-yl)-N-(2-methylpropyl)-1,1-diphenylpropan-2-imine |
| SMILES | CCN1CCC(C(/C(C)=N/CC(C)C)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C25H34N2/c1-5-27-17-16-24(19-27)25(21(4)26-18-20(2)3,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,20,24H,5,16-19H2,1-4H3/b26-21+ |
| InChIKey | IIOJLENWRARXSV-YYADALCUSA-N |
| XLogP | 5.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|