C29H35NO2 — CID 143291483
1-cyclohexa-1,3-dien-1-yl-1-phenyl-1-[1-(2-phenylmethoxyethyl)piperidin-3-yl]propan-2-one (PubChem CID 143291483) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-1-phenyl-1-[1-(2-phenylmethoxyethyl)piperidin-3-yl]propan-2-one.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-1-phenyl-1-[1-(2-phenylmethoxyethyl)piperidin-3-yl]propan-2-one |
|---|---|
| PubChem CID | 143291483 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-1-phenyl-1-[1-(2-phenylmethoxyethyl)piperidin-3-yl]propan-2-one |
| SMILES | CC(=O)C(C1=CC=CCC1)(c1ccccc1)C1CCCN(CCOCc2ccccc2)C1 |
| InChI | InChI=1S/C29H35NO2/c1-24(31)29(26-14-7-3-8-15-26,27-16-9-4-10-17-27)28-18-11-19-30(22-28)20-21-32-23-25-12-5-2-6-13-25/h2-9,12-16,28H,10-11,17-23H2,1H3 |
| InChIKey | DUTIKKZSPUFQNM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|