C28H32N2O2 — CID 140527497
2-[(2S,3S)-1-methyl-2-(2-phenylmethoxyethyl)pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 140527497) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[(2S,3S)-1-methyl-2-(2-phenylmethoxyethyl)pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(2S,3S)-1-methyl-2-(2-phenylmethoxyethyl)pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 140527497 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2-[(2S,3S)-1-methyl-2-(2-phenylmethoxyethyl)pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | CN1CC[C@@H](C(C(N)=O)(c2ccccc2)c2ccccc2)[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C28H32N2O2/c1-30-19-17-25(26(30)18-20-32-21-22-11-5-2-6-12-22)28(27(29)31,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-16,25-26H,17-21H2,1H3,(H2,29,31)/t25-,26+/m1/s1 |
| InChIKey | PVCQOBVAQZCVLQ-FTJBHMTQSA-N |
| XLogP | 4.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|