C35H41N4O4+ — CID 20625173
[(E)-4-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]but-2-enyl]-[2-(1,3-dioxoisoindol-2-yl)ethyl]-dimethylazanium (PubChem CID 20625173) has the molecular formula C35H41N4O4+ and a molecular weight of 581.74 g/mol. Its IUPAC name is [(E)-4-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]but-2-enyl]-[2-(1,3-dioxoisoindol-2-yl)ethyl]-dimethylazanium.
| Compound Name | [(E)-4-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]but-2-enyl]-[2-(1,3-dioxoisoindol-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 20625173 |
| Molecular Formula | C35H41N4O4+ |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | [(E)-4-[4-(benzhydrylcarbamoyloxy)piperidin-1-yl]but-2-enyl]-[2-(1,3-dioxoisoindol-2-yl)ethyl]-dimethylazanium |
| SMILES | C[N+](C)(C/C=C/CN1CCC(OC(=O)NC(c2ccccc2)c2ccccc2)CC1)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C35H40N4O4/c1-39(2,26-24-38-33(40)30-17-9-10-18-31(30)34(38)41)25-12-11-21-37-22-19-29(20-23-37)43-35(42)36-32(27-13-5-3-6-14-27)28-15-7-4-8-16-28/h3-18,29,32H,19-26H2,1-2H3/p+1/b12-11+ |
| InChIKey | XVZQZIORVPXIRM-VAWYXSNFSA-O |
| XLogP | 4.90 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|