C28H32N2O2 — CID 139674543
[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl] N-benzhydrylcarbamate (PubChem CID 139674543) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is [1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl] N-benzhydrylcarbamate.
| Compound Name | [1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl] N-benzhydrylcarbamate |
|---|---|
| PubChem CID | 139674543 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | [1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl] N-benzhydrylcarbamate |
| SMILES | Cc1ccc(CN2CCC(OC(=O)NC(c3ccccc3)c3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C28H32N2O2/c1-21-13-14-23(19-22(21)2)20-30-17-15-26(16-18-30)32-28(31)29-27(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-14,19,26-27H,15-18,20H2,1-2H3,(H,29,31) |
| InChIKey | MNSZSHARJIEIFA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |