C24H31N3O2 — CID 139674545
[1-[(3-aminophenyl)methyl]piperidin-4-yl] N-[cyclobutyl(phenyl)methyl]carbamate (PubChem CID 139674545) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is [1-[(3-aminophenyl)methyl]piperidin-4-yl] N-[cyclobutyl(phenyl)methyl]carbamate.
| Compound Name | [1-[(3-aminophenyl)methyl]piperidin-4-yl] N-[cyclobutyl(phenyl)methyl]carbamate |
|---|---|
| PubChem CID | 139674545 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | [1-[(3-aminophenyl)methyl]piperidin-4-yl] N-[cyclobutyl(phenyl)methyl]carbamate |
| SMILES | Nc1cccc(CN2CCC(OC(=O)NC(c3ccccc3)C3CCC3)CC2)c1 |
| InChI | InChI=1S/C24H31N3O2/c25-21-11-4-6-18(16-21)17-27-14-12-22(13-15-27)29-24(28)26-23(20-9-5-10-20)19-7-2-1-3-8-19/h1-4,6-8,11,16,20,22-23H,5,9-10,12-15,17,25H2,(H,26,28) |
| InChIKey | KQCUMLVXVCKVHZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|