About [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate
[1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate (PubChem CID 139674501) has the molecular formula C27H28N4O2
and a molecular weight of 440.55 g/mol. Its IUPAC name is [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate.
Molecular Properties
| Compound Name | [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate |
| PubChem CID | 139674501 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)OC1CCN(Cc2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C27H28N4O2/c32-27(30-26(21-7-3-1-4-8-21)22-9-5-2-6-10-22)33-23-13-15-31(16-14-23)18-20-11-12-24-25(17-20)29-19-28-24/h1-12,17,19,23,26H,13-16,18H2,(H,28,29)(H,30,32) |
| InChIKey | OPXCVPOPEXYHDP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate?
The IUPAC name of [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate (CID 139674501) is [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate.
What is the SMILES notation for [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate?
The canonical SMILES for [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate is O=C(NC(c1ccccc1)c1ccccc1)OC1CCN(Cc2ccc3nc[nH]c3c2)CC1.
What is the InChIKey of [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate?
The InChIKey is OPXCVPOPEXYHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N4O2/c32-27(30-26(21-7-3-1-4-8-21)22-9-5-2-6-10-22)33-23-13-15-31(16-14-23)18-20-11-12-24-25(17-20)29-19-28-24/h1-12,17,19,23,26H,13-16,18H2,(H,28,29)(H,30,32).
What are the key properties of [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate?
[1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate has a molecular weight of 440.55 g/mol, XLogP of 5.04, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3H-benzimidazol-5-ylmethyl)piperidin-4-yl] N-benzhydrylcarbamate is sourced from PubChem (CID 139674501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).