C20H22FN3O2 — CID 129454135
1-(3H-benzimidazol-5-ylmethyl)-4-[(4-fluorophenoxy)methyl]piperidin-4-ol (PubChem CID 129454135) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-ylmethyl)-4-[(4-fluorophenoxy)methyl]piperidin-4-ol.
| Compound Name | 1-(3H-benzimidazol-5-ylmethyl)-4-[(4-fluorophenoxy)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 129454135 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-(3H-benzimidazol-5-ylmethyl)-4-[(4-fluorophenoxy)methyl]piperidin-4-ol |
| SMILES | OC1(COc2ccc(F)cc2)CCN(Cc2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C20H22FN3O2/c21-16-2-4-17(5-3-16)26-13-20(25)7-9-24(10-8-20)12-15-1-6-18-19(11-15)23-14-22-18/h1-6,11,14,25H,7-10,12-13H2,(H,22,23) |
| InChIKey | CWNVQFGSGALQMH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |