About 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole
6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole (PubChem CID 129457203) has the molecular formula C21H23Cl2N3O2
and a molecular weight of 420.34 g/mol. Its IUPAC name is 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole |
| PubChem CID | 129457203 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole |
| SMILES | COC1(COc2ccc(Cl)c(Cl)c2)CCN(Cc2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C21H23Cl2N3O2/c1-27-21(13-28-16-3-4-17(22)18(23)11-16)6-8-26(9-7-21)12-15-2-5-19-20(10-15)25-14-24-19/h2-5,10-11,14H,6-9,12-13H2,1H3,(H,24,25) |
| InChIKey | ONOUDEUOTQFRIO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole?
The IUPAC name of 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole (CID 129457203) is 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole.
What is the SMILES notation for 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole?
The canonical SMILES for 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole is COC1(COc2ccc(Cl)c(Cl)c2)CCN(Cc2ccc3nc[nH]c3c2)CC1.
What is the InChIKey of 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole?
The InChIKey is ONOUDEUOTQFRIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23Cl2N3O2/c1-27-21(13-28-16-3-4-17(22)18(23)11-16)6-8-26(9-7-21)12-15-2-5-19-20(10-15)25-14-24-19/h2-5,10-11,14H,6-9,12-13H2,1H3,(H,24,25).
What are the key properties of 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole?
6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole has a molecular weight of 420.34 g/mol, XLogP of 4.93, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-[(3,4-dichlorophenoxy)methyl]-4-methoxypiperidin-1-yl]methyl]-1H-benzimidazole is sourced from PubChem (CID 129457203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).