C24H32ClNO5 — CID 129453637
4-[(3-chlorophenoxy)methyl]-4-methoxy-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]piperidine (PubChem CID 129453637) has the molecular formula C24H32ClNO5 and a molecular weight of 449.98 g/mol. Its IUPAC name is 4-[(3-chlorophenoxy)methyl]-4-methoxy-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]piperidine.
| Compound Name | 4-[(3-chlorophenoxy)methyl]-4-methoxy-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 129453637 |
| Molecular Formula | C24H32ClNO5 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 4-[(3-chlorophenoxy)methyl]-4-methoxy-1-[[4-methoxy-3-(2-methoxyethoxy)phenyl]methyl]piperidine |
| SMILES | COCCOc1cc(CN2CCC(COc3cccc(Cl)c3)(OC)CC2)ccc1OC |
| InChI | InChI=1S/C24H32ClNO5/c1-27-13-14-30-23-15-19(7-8-22(23)28-2)17-26-11-9-24(29-3,10-12-26)18-31-21-6-4-5-20(25)16-21/h4-8,15-16H,9-14,17-18H2,1-3H3 |
| InChIKey | BGWPYAGQNUYMKO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|